C10H12O3 — CID 102501403
2-[(E)-2-(furan-2-yl)ethenyl]-1,4-dioxane (PubChem CID 102501403) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-[(E)-2-(furan-2-yl)ethenyl]-1,4-dioxane.
| Compound Name | 2-[(E)-2-(furan-2-yl)ethenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 102501403 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-[(E)-2-(furan-2-yl)ethenyl]-1,4-dioxane |
| SMILES | C(=C/C1COCCO1)\c1ccco1 |
| InChI | InChI=1S/C10H12O3/c1-2-9(12-5-1)3-4-10-8-11-6-7-13-10/h1-5,10H,6-8H2/b4-3+ |
| InChIKey | JDVICYCAQMGWMP-ONEGZZNKSA-N |
| XLogP | 1.71 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |