C10H11NO2 — CID 131234360
(5S)-5-[(Z)-2-(furan-2-yl)ethenyl]pyrrolidin-2-one (PubChem CID 131234360) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is (5S)-5-[(Z)-2-(furan-2-yl)ethenyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[(Z)-2-(furan-2-yl)ethenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 131234360 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (5S)-5-[(Z)-2-(furan-2-yl)ethenyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](/C=C\c2ccco2)N1 |
| InChI | InChI=1S/C10H11NO2/c12-10-6-4-8(11-10)3-5-9-2-1-7-13-9/h1-3,5,7-8H,4,6H2,(H,11,12)/b5-3-/t8-/m1/s1 |
| InChIKey | FMCLUHDDDJVCSI-QIUOEGRZSA-N |
| XLogP | 1.57 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |