C17H18N2O2S — CID 7275297
(2S,7S)-2-[(E)-2-(furan-2-yl)ethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7275297) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2S,7S)-2-[(E)-2-(furan-2-yl)ethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-2-[(E)-2-(furan-2-yl)ethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7275297 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S,7S)-2-[(E)-2-(furan-2-yl)ethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCc2c(sc3c2C(=O)N[C@H](/C=C/c2ccco2)N3)C1 |
| InChI | InChI=1S/C17H18N2O2S/c1-10-4-6-12-13(9-10)22-17-15(12)16(20)18-14(19-17)7-5-11-3-2-8-21-11/h2-3,5,7-8,10,14,19H,4,6,9H2,1H3,(H,18,20)/b7-5+/t10-,14-/m0/s1 |
| InChIKey | SPSULWZFEMMPFP-AUZMMHNKSA-N |
| XLogP | 3.66 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |