C19H19N3O3S — CID 7287861
(2S,7S)-7-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7287861) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (2S,7S)-7-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-7-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7287861 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (2S,7S)-7-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCc2c(sc3c2C(=O)N[C@H](/C=C/c2cccc([N+](=O)[O-])c2)N3)C1 |
| InChI | InChI=1S/C19H19N3O3S/c1-11-5-7-14-15(9-11)26-19-17(14)18(23)20-16(21-19)8-6-12-3-2-4-13(10-12)22(24)25/h2-4,6,8,10-11,16,21H,5,7,9H2,1H3,(H,20,23)/b8-6+/t11-,16-/m0/s1 |
| InChIKey | HVYBXXQTRHGROY-NSNHRWCXSA-N |
| XLogP | 3.98 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|