C19H19BrN2OS — CID 2347035
(2S,7S)-2-[(Z)-1-bromo-2-phenylethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 2347035) has the molecular formula C19H19BrN2OS and a molecular weight of 403.35 g/mol. Its IUPAC name is (2S,7S)-2-[(Z)-1-bromo-2-phenylethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (2S,7S)-2-[(Z)-1-bromo-2-phenylethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 2347035 |
| Molecular Formula | C19H19BrN2OS |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | (2S,7S)-2-[(Z)-1-bromo-2-phenylethenyl]-7-methyl-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCc2c(sc3c2C(=O)N[C@H](/C(Br)=C/c2ccccc2)N3)C1 |
| InChI | InChI=1S/C19H19BrN2OS/c1-11-7-8-13-15(9-11)24-19-16(13)18(23)21-17(22-19)14(20)10-12-5-3-2-4-6-12/h2-6,10-11,17,22H,7-9H2,1H3,(H,21,23)/b14-10-/t11-,17-/m0/s1 |
| InChIKey | GIHBWWLOIRVEPK-ONZQWPQYSA-N |
| XLogP | 4.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |