C24H30N2OS — CID 3472798
7-(2-methylbutan-2-yl)-2-(1-phenylprop-1-en-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 3472798) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is 7-(2-methylbutan-2-yl)-2-(1-phenylprop-1-en-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(2-methylbutan-2-yl)-2-(1-phenylprop-1-en-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 3472798 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 7-(2-methylbutan-2-yl)-2-(1-phenylprop-1-en-2-yl)-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | CCC(C)(C)C1CCc2c(sc3c2C(=O)NC(C(C)=Cc2ccccc2)N3)C1 |
| InChI | InChI=1S/C24H30N2OS/c1-5-24(3,4)17-11-12-18-19(14-17)28-23-20(18)22(27)25-21(26-23)15(2)13-16-9-7-6-8-10-16/h6-10,13,17,21,26H,5,11-12,14H2,1-4H3,(H,25,27) |
| InChIKey | BSAZLPIDHYDOHS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |