C24H21BrN2O4S — CID 26876247
[4-bromo-2-[(2S,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 26876247) has the molecular formula C24H21BrN2O4S and a molecular weight of 513.41 g/mol. Its IUPAC name is [4-bromo-2-[(2S,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [4-bromo-2-[(2S,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 26876247 |
| Molecular Formula | C24H21BrN2O4S |
| Molecular Weight | 513.41 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | [4-bromo-2-[(2S,7S)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | C[C@H]1CCc2c(sc3c2C(=O)N[C@H](c2cc(Br)ccc2OC(=O)/C=C/c2ccco2)N3)C1 |
| InChI | InChI=1S/C24H21BrN2O4S/c1-13-4-7-16-19(11-13)32-24-21(16)23(29)26-22(27-24)17-12-14(25)5-8-18(17)31-20(28)9-6-15-3-2-10-30-15/h2-3,5-6,8-10,12-13,22,27H,4,7,11H2,1H3,(H,26,29)/b9-6+/t13-,22-/m0/s1 |
| InChIKey | IIIAIUFFERGRTQ-SRQNNRJESA-N |
| XLogP | 5.70 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|