C24H20Br2N2O3S — CID 98192800
[4-bromo-2-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-bromobenzoate (PubChem CID 98192800) has the molecular formula C24H20Br2N2O3S and a molecular weight of 576.31 g/mol. Its IUPAC name is [4-bromo-2-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-bromobenzoate.
| Compound Name | [4-bromo-2-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 98192800 |
| Molecular Formula | C24H20Br2N2O3S |
| Molecular Weight | 576.31 g/mol |
| Exact Mass | 573.96 |
| IUPAC Name | [4-bromo-2-[(2R,7R)-7-methyl-4-oxo-2,3,5,6,7,8-hexahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]phenyl] 4-bromobenzoate |
| SMILES | C[C@@H]1CCc2c(sc3c2C(=O)N[C@@H](c2cc(Br)ccc2OC(=O)c2ccc(Br)cc2)N3)C1 |
| InChI | InChI=1S/C24H20Br2N2O3S/c1-12-2-8-16-19(10-12)32-23-20(16)22(29)27-21(28-23)17-11-15(26)7-9-18(17)31-24(30)13-3-5-14(25)6-4-13/h3-7,9,11-12,21,28H,2,8,10H2,1H3,(H,27,29)/t12-,21-/m1/s1 |
| InChIKey | OATHHBJZNPAWNN-XUSGNXJCSA-N |
| XLogP | 6.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.31 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|