C10H12O3 — CID 44631270
2-[(E)-2-(furan-2-yl)ethenyl]-4-methyl-1,3-dioxolane (PubChem CID 44631270) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-[(E)-2-(furan-2-yl)ethenyl]-4-methyl-1,3-dioxolane.
| Compound Name | 2-[(E)-2-(furan-2-yl)ethenyl]-4-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 44631270 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-[(E)-2-(furan-2-yl)ethenyl]-4-methyl-1,3-dioxolane |
| SMILES | CC1COC(/C=C/c2ccco2)O1 |
| InChI | InChI=1S/C10H12O3/c1-8-7-12-10(13-8)5-4-9-3-2-6-11-9/h2-6,8,10H,7H2,1H3/b5-4+ |
| InChIKey | XPRRSKMOCXGHHE-SNAWJCMRSA-N |
| XLogP | 2.05 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |