C11H20O6 — CID 102504527
(3aS,5R,6R,7S,7aS)-6,7-dimethoxy-5-(methoxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran (PubChem CID 102504527) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is (3aS,5R,6R,7S,7aS)-6,7-dimethoxy-5-(methoxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran.
| Compound Name | (3aS,5R,6R,7S,7aS)-6,7-dimethoxy-5-(methoxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
|---|---|
| PubChem CID | 102504527 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (3aS,5R,6R,7S,7aS)-6,7-dimethoxy-5-(methoxymethyl)-2-methyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran |
| SMILES | COC[C@H]1O[C@H]2OC(C)O[C@H]2[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C11H20O6/c1-6-15-10-9(14-4)8(13-3)7(5-12-2)17-11(10)16-6/h6-11H,5H2,1-4H3/t6?,7-,8-,9+,10+,11-/m1/s1 |
| InChIKey | CETPYLXYLWMKEZ-UQXNILSOSA-N |
| XLogP | 0.15 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |