C14H21NO3 — CID 102505212
ethyl (5aR,8S,8aS,8bS)-8-methyl-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate (PubChem CID 102505212) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl (5aR,8S,8aS,8bS)-8-methyl-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate.
| Compound Name | ethyl (5aR,8S,8aS,8bS)-8-methyl-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate |
|---|---|
| PubChem CID | 102505212 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | ethyl (5aR,8S,8aS,8bS)-8-methyl-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate |
| SMILES | CCOC(=O)[C@@]12CCCN1C[C@@H]1C(=O)C[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C14H21NO3/c1-3-18-13(17)14-5-4-6-15(14)8-10-11(16)7-9(2)12(10)14/h9-10,12H,3-8H2,1-2H3/t9-,10+,12-,14-/m0/s1 |
| InChIKey | PDIDWILYDSBNHC-QPPBUOOMSA-N |
| XLogP | 1.24 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |