C12H19NO3 — CID 11075083
ethyl (3R,3aR,4R,6aS)-2,4-dimethyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylate (PubChem CID 11075083) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is ethyl (3R,3aR,4R,6aS)-2,4-dimethyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylate.
| Compound Name | ethyl (3R,3aR,4R,6aS)-2,4-dimethyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11075083 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethyl (3R,3aR,4R,6aS)-2,4-dimethyl-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2[C@H](C)CC(=O)[C@@H]2CN1C |
| InChI | InChI=1S/C12H19NO3/c1-4-16-12(15)11-10-7(2)5-9(14)8(10)6-13(11)3/h7-8,10-11H,4-6H2,1-3H3/t7-,8+,10-,11-/m1/s1 |
| InChIKey | UPFGLWGZHOJUCK-JZSSXWJLSA-N |
| XLogP | 0.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |