C13H19NO3 — CID 11746661
ethyl (5aS,8aR,8bR)-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate (PubChem CID 11746661) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethyl (5aS,8aR,8bR)-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate.
| Compound Name | ethyl (5aS,8aR,8bR)-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate |
|---|---|
| PubChem CID | 11746661 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethyl (5aS,8aR,8bR)-6-oxo-1,2,3,5,5a,7,8,8a-octahydrocyclopenta[a]pyrrolizine-8b-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCN1C[C@H]1C(=O)CC[C@H]12 |
| InChI | InChI=1S/C13H19NO3/c1-2-17-12(16)13-6-3-7-14(13)8-9-10(13)4-5-11(9)15/h9-10H,2-8H2,1H3/t9-,10-,13-/m1/s1 |
| InChIKey | JYZFYCIAEPATSV-GIPNMCIBSA-N |
| XLogP | 0.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |