About cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate)
cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) (PubChem CID 102507445) has the molecular formula C52H82CoO4
and a molecular weight of 830.16 g/mol. Its IUPAC name is cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate).
Molecular Properties
| Compound Name | cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) |
| PubChem CID | 102507445 |
| Molecular Formula | C52H82CoO4 |
| Molecular Weight | 830.16 g/mol |
| Exact Mass | 829.55 |
| IUPAC Name | cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) |
| SMILES | C=Cc1ccc(C(CCCCCCCCC)CCCCCCCC(=O)[O-])cc1.C=Cc1ccc(C(CCCCCCCCC)CCCCCCCC(=O)[O-])cc1.[Co+2] |
| InChI | InChI=1S/2C26H42O2.Co/c2*1-3-5-6-7-8-10-13-16-24(25-21-19-23(4-2)20-22-25)17-14-11-9-12-15-18-26(27)28;/h2*4,19-22,24H,2-3,5-18H2,1H3,(H,27,28);/q;;+2/p-2 |
| InChIKey | KWABOORAIJNAGP-UHFFFAOYSA-L |
| XLogP | 14.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 830.16 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate)?
The IUPAC name of cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) (CID 102507445) is cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate).
What is the SMILES notation for cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate)?
The canonical SMILES for cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) is C=Cc1ccc(C(CCCCCCCCC)CCCCCCCC(=O)[O-])cc1.C=Cc1ccc(C(CCCCCCCCC)CCCCCCCC(=O)[O-])cc1.[Co+2].
What is the InChIKey of cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate)?
The InChIKey is KWABOORAIJNAGP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C26H42O2.Co/c2*1-3-5-6-7-8-10-13-16-24(25-21-19-23(4-2)20-22-25)17-14-11-9-12-15-18-26(27)28;/h2*4,19-22,24H,2-3,5-18H2,1H3,(H,27,28);/q;;+2/p-2.
What are the key properties of cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate)?
cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) has a molecular weight of 830.16 g/mol, XLogP of 14.07, 36 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(9-(4-ethenylphenyl)octadecanoate) is sourced from PubChem (CID 102507445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).