About cobalt(2+);bis(heptanoate)
cobalt(2+);bis(heptanoate) (PubChem CID 14298657) has the molecular formula C14H26CoO4
and a molecular weight of 317.29 g/mol. Its IUPAC name is cobalt(2+);bis(heptanoate).
Molecular Properties
| Compound Name | cobalt(2+);bis(heptanoate) |
| PubChem CID | 14298657 |
| Molecular Formula | C14H26CoO4 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | cobalt(2+);bis(heptanoate) |
| SMILES | CCCCCCC(=O)[O-].CCCCCCC(=O)[O-].[Co+2] |
| InChI | InChI=1S/2C7H14O2.Co/c2*1-2-3-4-5-6-7(8)9;/h2*2-6H2,1H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | FDPHDGUADUFPHZ-UHFFFAOYSA-L |
| XLogP | 1.41 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);bis(heptanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);bis(heptanoate)?
The IUPAC name of cobalt(2+);bis(heptanoate) (CID 14298657) is cobalt(2+);bis(heptanoate).
What is the SMILES notation for cobalt(2+);bis(heptanoate)?
The canonical SMILES for cobalt(2+);bis(heptanoate) is CCCCCCC(=O)[O-].CCCCCCC(=O)[O-].[Co+2].
What is the InChIKey of cobalt(2+);bis(heptanoate)?
The InChIKey is FDPHDGUADUFPHZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H14O2.Co/c2*1-2-3-4-5-6-7(8)9;/h2*2-6H2,1H3,(H,8,9);/q;;+2/p-2.
What are the key properties of cobalt(2+);bis(heptanoate)?
cobalt(2+);bis(heptanoate) has a molecular weight of 317.29 g/mol, XLogP of 1.41, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);bis(heptanoate) is sourced from PubChem (CID 14298657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).