C12H16O3 — CID 102507463
(3aS,5aS,8bS)-2,2-dimethyl-3a,4,5,5a,6,8b-hexahydroindeno[4,5-d][1,3]dioxol-7-one (PubChem CID 102507463) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3aS,5aS,8bS)-2,2-dimethyl-3a,4,5,5a,6,8b-hexahydroindeno[4,5-d][1,3]dioxol-7-one.
| Compound Name | (3aS,5aS,8bS)-2,2-dimethyl-3a,4,5,5a,6,8b-hexahydroindeno[4,5-d][1,3]dioxol-7-one |
|---|---|
| PubChem CID | 102507463 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3aS,5aS,8bS)-2,2-dimethyl-3a,4,5,5a,6,8b-hexahydroindeno[4,5-d][1,3]dioxol-7-one |
| SMILES | CC1(C)O[C@H]2CC[C@H]3CC(=O)C=C3[C@@H]2O1 |
| InChI | InChI=1S/C12H16O3/c1-12(2)14-10-4-3-7-5-8(13)6-9(7)11(10)15-12/h6-7,10-11H,3-5H2,1-2H3/t7-,10-,11-/m0/s1 |
| InChIKey | BPZSBSBMRILHSK-SWPVVBRQSA-N |
| XLogP | 1.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |