C60H102O18 — CID 71819205
(1S,19S,23S,41S,45S,63S)-21,21,43,43,65,65-hexamethyl-8,12,20,22,30,34,42,44,52,56,64,66-dodecaoxatetracyclo[61.3.0.019,23.041,45]hexahexacontane-9,11,31,33,53,55-hexone (PubChem CID 71819205) has the molecular formula C60H102O18 and a molecular weight of 1111.46 g/mol. Its IUPAC name is (1S,19S,23S,41S,45S,63S)-21,21,43,43,65,65-hexamethyl-8,12,20,22,30,34,42,44,52,56,64,66-dodecaoxatetracyclo[61.3.0.019,23.041,45]hexahexacontane-9,11,31,33,53,55-hexone.
| Compound Name | (1S,19S,23S,41S,45S,63S)-21,21,43,43,65,65-hexamethyl-8,12,20,22,30,34,42,44,52,56,64,66-dodecaoxatetracyclo[61.3.0.019,23.041,45]hexahexacontane-9,11,31,33,53,55-hexone |
|---|---|
| PubChem CID | 71819205 |
| Molecular Formula | C60H102O18 |
| Molecular Weight | 1111.46 g/mol |
| Exact Mass | 1110.71 |
| IUPAC Name | (1S,19S,23S,41S,45S,63S)-21,21,43,43,65,65-hexamethyl-8,12,20,22,30,34,42,44,52,56,64,66-dodecaoxatetracyclo[61.3.0.019,23.041,45]hexahexacontane-9,11,31,33,53,55-hexone |
| SMILES | CC1(C)O[C@H]2CCCCCCOC(=O)CC(=O)OCCCCCC[C@@H]3OC(C)(C)O[C@H]3CCCCCCOC(=O)CC(=O)OCCCCCC[C@@H]3OC(C)(C)O[C@H]3CCCCCCOC(=O)CC(=O)OCCCCCC[C@@H]2O1 |
| InChI | InChI=1S/C60H102O18/c1-58(2)73-46-31-19-7-13-25-37-67-52(61)43-54(63)69-39-27-15-9-21-33-48-50(77-59(3,4)75-48)35-23-11-17-29-41-71-56(65)45-57(66)72-42-30-18-12-24-36-51-49(76-60(5,6)78-51)34-22-10-16-28-40-70-55(64)44-53(62)68-38-26-14-8-20-32-47(46)74-58/h46-51H,7-45H2,1-6H3/t46-,47-,48-,49-,50-,51-/m0/s1 |
| InChIKey | ARALCQIVDCYNHL-QXYUJABFSA-N |
| XLogP | 11.69 |
| TPSA | 213.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1111.46 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|