C15H20O5 — CID 10378912
(1R,2S,7R,10R,12R,16R)-3-hydroxy-14,14-dimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-3-en-5-one (PubChem CID 10378912) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,2S,7R,10R,12R,16R)-3-hydroxy-14,14-dimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-3-en-5-one.
| Compound Name | (1R,2S,7R,10R,12R,16R)-3-hydroxy-14,14-dimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-3-en-5-one |
|---|---|
| PubChem CID | 10378912 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R,2S,7R,10R,12R,16R)-3-hydroxy-14,14-dimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadec-3-en-5-one |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CC[C@@H]4CC(=O)C=C(O)[C@@H]4[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C15H20O5/c1-15(2)19-13-12-10(18-14(13)20-15)4-3-7-5-8(16)6-9(17)11(7)12/h6-7,10-14,17H,3-5H2,1-2H3/t7-,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | AVCILLJCDBHMAY-XCUKTEDPSA-N |
| XLogP | 1.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |