C16H24O4 — CID 10446389
(1R,2S,7R,10R,12R,16R)-5,14,14-trimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadecan-3-one (PubChem CID 10446389) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R,2S,7R,10R,12R,16R)-5,14,14-trimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadecan-3-one.
| Compound Name | (1R,2S,7R,10R,12R,16R)-5,14,14-trimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadecan-3-one |
|---|---|
| PubChem CID | 10446389 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,2S,7R,10R,12R,16R)-5,14,14-trimethyl-11,13,15-trioxatetracyclo[8.6.0.02,7.012,16]hexadecan-3-one |
| SMILES | CC1CC(=O)[C@H]2[C@H](CC[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]23)C1 |
| InChI | InChI=1S/C16H24O4/c1-8-6-9-4-5-11-13(12(9)10(17)7-8)14-15(18-11)20-16(2,3)19-14/h8-9,11-15H,4-7H2,1-3H3/t8?,9-,11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | ICPQXOQYOMDXJE-IVAOCGOQSA-N |
| XLogP | 2.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |