C8H15NO2 — CID 102508248
(3R)-3-[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium (PubChem CID 102508248) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is (3R)-3-[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium.
| Compound Name | (3R)-3-[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium |
|---|---|
| PubChem CID | 102508248 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (3R)-3-[(2-methylpropan-2-yl)oxy]-1-oxido-3,4-dihydro-2H-pyrrol-1-ium |
| SMILES | CC(C)(C)O[C@@H]1CC=[N+]([O-])C1 |
| InChI | InChI=1S/C8H15NO2/c1-8(2,3)11-7-4-5-9(10)6-7/h5,7H,4,6H2,1-3H3/t7-/m1/s1 |
| InChIKey | SXHQCADVWYOVHW-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 35.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|