C17H24F2O2 — CID 102508598
5-butoxy-3-[(3,4-difluorophenyl)methyl]-2,2-dimethyloxolane (PubChem CID 102508598) has the molecular formula C17H24F2O2 and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-butoxy-3-[(3,4-difluorophenyl)methyl]-2,2-dimethyloxolane.
| Compound Name | 5-butoxy-3-[(3,4-difluorophenyl)methyl]-2,2-dimethyloxolane |
|---|---|
| PubChem CID | 102508598 |
| Molecular Formula | C17H24F2O2 |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 5-butoxy-3-[(3,4-difluorophenyl)methyl]-2,2-dimethyloxolane |
| SMILES | CCCCOC1CC(Cc2ccc(F)c(F)c2)C(C)(C)O1 |
| InChI | InChI=1S/C17H24F2O2/c1-4-5-8-20-16-11-13(17(2,3)21-16)9-12-6-7-14(18)15(19)10-12/h6-7,10,13,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | FWZGVHTUWWHMDN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|