C24H37F2IO2 — CID 11092589
fluoro-[(E)-2-fluoro-10-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dec-1-enyl]-(4-methylphenyl)-λ3-iodane (PubChem CID 11092589) has the molecular formula C24H37F2IO2 and a molecular weight of 522.46 g/mol. Its IUPAC name is fluoro-[(E)-2-fluoro-10-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dec-1-enyl]-(4-methylphenyl)-λ3-iodane.
| Compound Name | fluoro-[(E)-2-fluoro-10-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dec-1-enyl]-(4-methylphenyl)-λ3-iodane |
|---|---|
| PubChem CID | 11092589 |
| Molecular Formula | C24H37F2IO2 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | fluoro-[(E)-2-fluoro-10-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dec-1-enyl]-(4-methylphenyl)-λ3-iodane |
| SMILES | Cc1ccc(I(F)/C=C(/F)CCCCCCCCC2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C24H37F2IO2/c1-19-14-16-21(17-15-19)27(26)18-20(25)12-10-8-6-7-9-11-13-22-28-23(2,3)24(4,5)29-22/h14-18,22H,6-13H2,1-5H3/b20-18+ |
| InChIKey | YWESVYKHGOZYIR-CZIZESTLSA-N |
| XLogP | 8.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|