C15H16N2O2 — CID 102511473
(1S,7R,8R,9S)-4-benzyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-diol (PubChem CID 102511473) has the molecular formula C15H16N2O2 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1S,7R,8R,9S)-4-benzyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-diol.
| Compound Name | (1S,7R,8R,9S)-4-benzyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-diol |
|---|---|
| PubChem CID | 102511473 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (1S,7R,8R,9S)-4-benzyl-3,4-diazatricyclo[5.2.1.02,6]deca-2,5-diene-8,9-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H]2C[C@H]1c1nn(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C15H16N2O2/c18-14-10-6-11(15(14)19)13-12(10)8-17(16-13)7-9-4-2-1-3-5-9/h1-5,8,10-11,14-15,18-19H,6-7H2/t10-,11+,14-,15+/m1/s1 |
| InChIKey | UMBCKAVHQPMJAB-BVIHXZOGSA-N |
| XLogP | 1.24 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |