C21H17Cl2N3O2 — CID 10251199
1-(2,3-dichlorophenyl)-3-[1-(3-pyridin-4-yloxyphenyl)cyclopropyl]urea (PubChem CID 10251199) has the molecular formula C21H17Cl2N3O2 and a molecular weight of 414.29 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[1-(3-pyridin-4-yloxyphenyl)cyclopropyl]urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[1-(3-pyridin-4-yloxyphenyl)cyclopropyl]urea |
|---|---|
| PubChem CID | 10251199 |
| Molecular Formula | C21H17Cl2N3O2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[1-(3-pyridin-4-yloxyphenyl)cyclopropyl]urea |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)NC1(c2cccc(Oc3ccncc3)c2)CC1 |
| InChI | InChI=1S/C21H17Cl2N3O2/c22-17-5-2-6-18(19(17)23)25-20(27)26-21(9-10-21)14-3-1-4-16(13-14)28-15-7-11-24-12-8-15/h1-8,11-13H,9-10H2,(H2,25,26,27) |
| InChIKey | GAOVDIYOOYKVPC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |