C23H25FN6O3S — CID 102514699
(3R,6S)-6-cyclopropyl-3-[5-fluoro-2-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-4-pyridinyl]-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 102514699) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is (3R,6S)-6-cyclopropyl-3-[5-fluoro-2-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-4-pyridinyl]-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-6-cyclopropyl-3-[5-fluoro-2-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-4-pyridinyl]-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 102514699 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (3R,6S)-6-cyclopropyl-3-[5-fluoro-2-[(3-methoxy-1,7-naphthyridin-8-yl)amino]-4-pyridinyl]-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | COc1cnc2c(Nc3cc([C@]4(C)CS(=O)(=O)[C@@](C)(C5CC5)C(N)=N4)c(F)cn3)nccc2c1 |
| InChI | InChI=1S/C23H25FN6O3S/c1-22(12-34(31,32)23(2,14-4-5-14)21(25)30-22)16-9-18(27-11-17(16)24)29-20-19-13(6-7-26-20)8-15(33-3)10-28-19/h6-11,14H,4-5,12H2,1-3H3,(H2,25,30)(H,26,27,29)/t22-,23-/m0/s1 |
| InChIKey | CVIKZJGUFZXXGR-GOTSBHOMSA-N |
| XLogP | 3.09 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |