C14H30OSi2 — CID 102520238
trimethyl-[(E)-1-(oxolan-2-yl)-4-trimethylsilylbut-3-en-2-yl]silane (PubChem CID 102520238) has the molecular formula C14H30OSi2 and a molecular weight of 270.56 g/mol. Its IUPAC name is trimethyl-[(E)-1-(oxolan-2-yl)-4-trimethylsilylbut-3-en-2-yl]silane.
| Compound Name | trimethyl-[(E)-1-(oxolan-2-yl)-4-trimethylsilylbut-3-en-2-yl]silane |
|---|---|
| PubChem CID | 102520238 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | trimethyl-[(E)-1-(oxolan-2-yl)-4-trimethylsilylbut-3-en-2-yl]silane |
| SMILES | C[Si](C)(C)/C=C/C(CC1CCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi2/c1-16(2,3)11-9-14(17(4,5)6)12-13-8-7-10-15-13/h9,11,13-14H,7-8,10,12H2,1-6H3/b11-9+ |
| InChIKey | DLJDHUCZWOASGK-PKNBQFBNSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|