C14H30OSi — CID 10586281
trimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]silane (PubChem CID 10586281) has the molecular formula C14H30OSi and a molecular weight of 242.48 g/mol. Its IUPAC name is trimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]silane.
| Compound Name | trimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]silane |
|---|---|
| PubChem CID | 10586281 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | trimethyl-[(1S)-1-[(2S)-pent-4-en-2-yl]oxyhexyl]silane |
| SMILES | C=CC[C@H](C)O[C@H](CCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C14H30OSi/c1-7-9-10-12-14(16(4,5)6)15-13(3)11-8-2/h8,13-14H,2,7,9-12H2,1,3-6H3/t13-,14-/m0/s1 |
| InChIKey | DDZHBZBRHAMEMK-KBPBESRZSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|