C15H31FOSi — CID 10754830
fluoro-dimethyl-[(1S)-1-[(3R)-2-methylhex-5-en-3-yl]oxyhexyl]silane (PubChem CID 10754830) has the molecular formula C15H31FOSi and a molecular weight of 274.50 g/mol. Its IUPAC name is fluoro-dimethyl-[(1S)-1-[(3R)-2-methylhex-5-en-3-yl]oxyhexyl]silane.
| Compound Name | fluoro-dimethyl-[(1S)-1-[(3R)-2-methylhex-5-en-3-yl]oxyhexyl]silane |
|---|---|
| PubChem CID | 10754830 |
| Molecular Formula | C15H31FOSi |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | fluoro-dimethyl-[(1S)-1-[(3R)-2-methylhex-5-en-3-yl]oxyhexyl]silane |
| SMILES | C=CC[C@@H](O[C@H](CCCCC)[Si](C)(C)F)C(C)C |
| InChI | InChI=1S/C15H31FOSi/c1-7-9-10-12-15(18(5,6)16)17-14(11-8-2)13(3)4/h8,13-15H,2,7,9-12H2,1,3-6H3/t14-,15+/m1/s1 |
| InChIKey | OWFWUTBXWNIROX-CABCVRRESA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|