C17H38O2Si2 — CID 10735222
dimethyl-[1-(3-methylpent-4-en-2-yloxy)hexyl]-trimethylsilyloxysilane (PubChem CID 10735222) has the molecular formula C17H38O2Si2 and a molecular weight of 330.66 g/mol. Its IUPAC name is dimethyl-[1-(3-methylpent-4-en-2-yloxy)hexyl]-trimethylsilyloxysilane.
| Compound Name | dimethyl-[1-(3-methylpent-4-en-2-yloxy)hexyl]-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 10735222 |
| Molecular Formula | C17H38O2Si2 |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | dimethyl-[1-(3-methylpent-4-en-2-yloxy)hexyl]-trimethylsilyloxysilane |
| SMILES | C=CC(C)C(C)OC(CCCCC)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O2Si2/c1-10-12-13-14-17(18-16(4)15(3)11-2)21(8,9)19-20(5,6)7/h11,15-17H,2,10,12-14H2,1,3-9H3 |
| InChIKey | GZHQWRDEZWWRPW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|