C15H32OSi — CID 10729807
trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]hept-1-enyl]silane (PubChem CID 10729807) has the molecular formula C15H32OSi and a molecular weight of 256.51 g/mol. Its IUPAC name is trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]hept-1-enyl]silane.
| Compound Name | trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]hept-1-enyl]silane |
|---|---|
| PubChem CID | 10729807 |
| Molecular Formula | C15H32OSi |
| Molecular Weight | 256.51 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]hept-1-enyl]silane |
| SMILES | CC[C@@H](OC(C)(C)C)[C@H](C)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C15H32OSi/c1-9-14(16-15(3,4)5)13(2)11-10-12-17(6,7)8/h10,12-14H,9,11H2,1-8H3/b12-10+/t13-,14-/m1/s1 |
| InChIKey | KHRODZGMIPQDBV-XMNZZIDVSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|