C14H32OSi2 — CID 11129450
[(Z,3R,4R)-4-ethyl-6-trimethylsilylhex-5-en-3-yl]oxy-trimethylsilane (PubChem CID 11129450) has the molecular formula C14H32OSi2 and a molecular weight of 272.58 g/mol. Its IUPAC name is [(Z,3R,4R)-4-ethyl-6-trimethylsilylhex-5-en-3-yl]oxy-trimethylsilane.
| Compound Name | [(Z,3R,4R)-4-ethyl-6-trimethylsilylhex-5-en-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 11129450 |
| Molecular Formula | C14H32OSi2 |
| Molecular Weight | 272.58 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | [(Z,3R,4R)-4-ethyl-6-trimethylsilylhex-5-en-3-yl]oxy-trimethylsilane |
| SMILES | CC[C@H](/C=C\[Si](C)(C)C)[C@@H](CC)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32OSi2/c1-9-13(11-12-16(3,4)5)14(10-2)15-17(6,7)8/h11-14H,9-10H2,1-8H3/b12-11-/t13-,14-/m1/s1 |
| InChIKey | IZYORSLBMLKUBN-QDLRVKAISA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|