C16H34OSi — CID 15668620
trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-enyl]silane (PubChem CID 15668620) has the molecular formula C16H34OSi and a molecular weight of 270.53 g/mol. Its IUPAC name is trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-enyl]silane.
| Compound Name | trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-enyl]silane |
|---|---|
| PubChem CID | 15668620 |
| Molecular Formula | C16H34OSi |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | trimethyl-[(E,4R,5R)-4-methyl-5-[(2-methylpropan-2-yl)oxy]oct-1-enyl]silane |
| SMILES | CCC[C@@H](OC(C)(C)C)[C@H](C)C/C=C/[Si](C)(C)C |
| InChI | InChI=1S/C16H34OSi/c1-9-11-15(17-16(3,4)5)14(2)12-10-13-18(6,7)8/h10,13-15H,9,11-12H2,1-8H3/b13-10+/t14-,15-/m1/s1 |
| InChIKey | JULUDKPIAODTBG-RTZSPXFWSA-N |
| XLogP | 5.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|