C22H38O — CID 175501318
4-(3,5-diethylhepta-1,6-dien-4-yloxy)-3,5-diethylhepta-1,6-diene (PubChem CID 175501318) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is 4-(3,5-diethylhepta-1,6-dien-4-yloxy)-3,5-diethylhepta-1,6-diene.
| Compound Name | 4-(3,5-diethylhepta-1,6-dien-4-yloxy)-3,5-diethylhepta-1,6-diene |
|---|---|
| PubChem CID | 175501318 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 4-(3,5-diethylhepta-1,6-dien-4-yloxy)-3,5-diethylhepta-1,6-diene |
| SMILES | C=CC(CC)C(OC(C(C=C)CC)C(C=C)CC)C(C=C)CC |
| InChI | InChI=1S/C22H38O/c1-9-17(10-2)21(18(11-3)12-4)23-22(19(13-5)14-6)20(15-7)16-8/h9,11,13,15,17-22H,1,3,5,7,10,12,14,16H2,2,4,6,8H3 |
| InChIKey | DQPKTQWWJCHLMD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|