C17H36OSi — CID 11460312
tert-butyl-dimethyl-[(5S,6R)-6-methyldec-9-en-5-yl]oxysilane (PubChem CID 11460312) has the molecular formula C17H36OSi and a molecular weight of 284.56 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S,6R)-6-methyldec-9-en-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(5S,6R)-6-methyldec-9-en-5-yl]oxysilane |
|---|---|
| PubChem CID | 11460312 |
| Molecular Formula | C17H36OSi |
| Molecular Weight | 284.56 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | tert-butyl-dimethyl-[(5S,6R)-6-methyldec-9-en-5-yl]oxysilane |
| SMILES | C=CCC[C@@H](C)[C@H](CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36OSi/c1-9-11-13-15(3)16(14-12-10-2)18-19(7,8)17(4,5)6/h9,15-16H,1,10-14H2,2-8H3/t15-,16+/m1/s1 |
| InChIKey | FUCMXVADCOVILM-CVEARBPZSA-N |
| XLogP | 6.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|