C27H58OSiSn — CID 74042255
triethyl-(5-methyl-1-tributylstannyloct-1-en-4-yl)oxysilane (PubChem CID 74042255) has the molecular formula C27H58OSiSn and a molecular weight of 545.56 g/mol. Its IUPAC name is triethyl-(5-methyl-1-tributylstannyloct-1-en-4-yl)oxysilane.
| Compound Name | triethyl-(5-methyl-1-tributylstannyloct-1-en-4-yl)oxysilane |
|---|---|
| PubChem CID | 74042255 |
| Molecular Formula | C27H58OSiSn |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | triethyl-(5-methyl-1-tributylstannyloct-1-en-4-yl)oxysilane |
| SMILES | CCCC[Sn](C=CCC(O[Si](CC)(CC)CC)C(C)CCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H31OSi.3C4H9.Sn/c1-7-12-14(6)15(13-8-2)16-17(9-3,10-4)11-5;3*1-3-4-2;/h2,8,14-15H,7,9-13H2,1,3-6H3;3*1,3-4H2,2H3; |
| InChIKey | XWDQRALKXXWXIO-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|