C20H36OSi — CID 162412726
3-[(2R,5S)-5-but-3-enyloxolan-2-yl]prop-1-ynyl-tri(propan-2-yl)silane (PubChem CID 162412726) has the molecular formula C20H36OSi and a molecular weight of 320.59 g/mol. Its IUPAC name is 3-[(2R,5S)-5-but-3-enyloxolan-2-yl]prop-1-ynyl-tri(propan-2-yl)silane.
| Compound Name | 3-[(2R,5S)-5-but-3-enyloxolan-2-yl]prop-1-ynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 162412726 |
| Molecular Formula | C20H36OSi |
| Molecular Weight | 320.59 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 3-[(2R,5S)-5-but-3-enyloxolan-2-yl]prop-1-ynyl-tri(propan-2-yl)silane |
| SMILES | C=CCC[C@H]1CC[C@H](CC#C[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C20H36OSi/c1-8-9-11-19-13-14-20(21-19)12-10-15-22(16(2)3,17(4)5)18(6)7/h8,16-20H,1,9,11-14H2,2-7H3/t19-,20-/m0/s1 |
| InChIKey | ZMOVIUSQQCAUGS-PMACEKPBSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.59 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|