C21H22O4 — CID 102521294
(3S)-3-benzyl-6-butyl-3-phenyl-1,4-dioxane-2,5-dione (PubChem CID 102521294) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (3S)-3-benzyl-6-butyl-3-phenyl-1,4-dioxane-2,5-dione.
| Compound Name | (3S)-3-benzyl-6-butyl-3-phenyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 102521294 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (3S)-3-benzyl-6-butyl-3-phenyl-1,4-dioxane-2,5-dione |
| SMILES | CCCCC1OC(=O)[C@](Cc2ccccc2)(c2ccccc2)OC1=O |
| InChI | InChI=1S/C21H22O4/c1-2-3-14-18-19(22)25-21(20(23)24-18,17-12-8-5-9-13-17)15-16-10-6-4-7-11-16/h4-13,18H,2-3,14-15H2,1H3/t18?,21-/m0/s1 |
| InChIKey | CEILIPDQERFSMM-ZYZRXSCRSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |