C18H12Cl2N2O2 — CID 102521934
2,6-bis(4-chlorophenyl)-3,7-diazatricyclo[4.2.0.02,5]octane-4,8-dione (PubChem CID 102521934) has the molecular formula C18H12Cl2N2O2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-3,7-diazatricyclo[4.2.0.02,5]octane-4,8-dione.
| Compound Name | 2,6-bis(4-chlorophenyl)-3,7-diazatricyclo[4.2.0.02,5]octane-4,8-dione |
|---|---|
| PubChem CID | 102521934 |
| Molecular Formula | C18H12Cl2N2O2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-3,7-diazatricyclo[4.2.0.02,5]octane-4,8-dione |
| SMILES | O=C1NC2(c3ccc(Cl)cc3)C1C1(c3ccc(Cl)cc3)NC(=O)C21 |
| InChI | InChI=1S/C18H12Cl2N2O2/c19-11-5-1-9(2-6-11)17-13(15(23)21-17)18(14(17)16(24)22-18)10-3-7-12(20)8-4-10/h1-8,13-14H,(H,21,23)(H,22,24) |
| InChIKey | QRZBDMJCXBRPSC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |