C13H6ClN3O2 — CID 6993512
(1R,5S)-6-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile (PubChem CID 6993512) has the molecular formula C13H6ClN3O2 and a molecular weight of 271.66 g/mol. Its IUPAC name is (1R,5S)-6-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile.
| Compound Name | (1R,5S)-6-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 6993512 |
| Molecular Formula | C13H6ClN3O2 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | (1R,5S)-6-(4-chlorophenyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
| SMILES | N#C[C@@]12C(=O)NC(=O)[C@]1(C#N)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H6ClN3O2/c14-8-3-1-7(2-4-8)9-12(5-15)10(18)17-11(19)13(9,12)6-16/h1-4,9H,(H,17,18,19)/t9?,12-,13+ |
| InChIKey | DATHMMINOJWYSL-MVCUKOFQSA-N |
| XLogP | 1.11 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|