C14H7N3O4 — CID 7357206
(1R,5S)-6-(1,3-benzodioxol-5-yl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile (PubChem CID 7357206) has the molecular formula C14H7N3O4 and a molecular weight of 281.23 g/mol. Its IUPAC name is (1R,5S)-6-(1,3-benzodioxol-5-yl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile.
| Compound Name | (1R,5S)-6-(1,3-benzodioxol-5-yl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
|---|---|
| PubChem CID | 7357206 |
| Molecular Formula | C14H7N3O4 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (1R,5S)-6-(1,3-benzodioxol-5-yl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-1,5-dicarbonitrile |
| SMILES | N#C[C@@]12C(=O)NC(=O)[C@]1(C#N)C2c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H7N3O4/c15-4-13-10(14(13,5-16)12(19)17-11(13)18)7-1-2-8-9(3-7)21-6-20-8/h1-3,10H,6H2,(H,17,18,19)/t10?,13-,14+ |
| InChIKey | JBXMSNZVHARBGV-FTNCPSPGSA-N |
| XLogP | 0.19 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|