C15H17N3O3S — CID 123166784
5-(1,3-benzodioxol-5-yl)-4-cyano-N,4-dimethyl-2-sulfanylpyrrolidine-2-carboxamide (PubChem CID 123166784) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-4-cyano-N,4-dimethyl-2-sulfanylpyrrolidine-2-carboxamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-4-cyano-N,4-dimethyl-2-sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 123166784 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-4-cyano-N,4-dimethyl-2-sulfanylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1(S)CC(C)(C#N)C(c2ccc3c(c2)OCO3)N1 |
| InChI | InChI=1S/C15H17N3O3S/c1-14(7-16)6-15(22,13(19)17-2)18-12(14)9-3-4-10-11(5-9)21-8-20-10/h3-5,12,18,22H,6,8H2,1-2H3,(H,17,19) |
| InChIKey | OUTPJKJRIVYTSX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|