C18H21N3O4 — CID 154999591
N-[1-[(3S)-2-(1,3-benzodioxol-5-yl)-3-cyano-3,5-dimethylpyrrolidin-1-yl]-1-oxopropan-2-yl]formamide (PubChem CID 154999591) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[1-[(3S)-2-(1,3-benzodioxol-5-yl)-3-cyano-3,5-dimethylpyrrolidin-1-yl]-1-oxopropan-2-yl]formamide.
| Compound Name | N-[1-[(3S)-2-(1,3-benzodioxol-5-yl)-3-cyano-3,5-dimethylpyrrolidin-1-yl]-1-oxopropan-2-yl]formamide |
|---|---|
| PubChem CID | 154999591 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[1-[(3S)-2-(1,3-benzodioxol-5-yl)-3-cyano-3,5-dimethylpyrrolidin-1-yl]-1-oxopropan-2-yl]formamide |
| SMILES | CC(NC=O)C(=O)N1C(C)C[C@](C)(C#N)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H21N3O4/c1-11-7-18(3,8-19)16(21(11)17(23)12(2)20-9-22)13-4-5-14-15(6-13)25-10-24-14/h4-6,9,11-12,16H,7,10H2,1-3H3,(H,20,22)/t11?,12?,16?,18-/m1/s1 |
| InChIKey | UUCXZDVTVHRSJX-FGVFCYBLSA-N |
| XLogP | 1.74 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|