C32H27N3O6S2 — CID 139311668
S-[(3S,7S,8aS)-6-(1,3-benzodioxol-5-yl)-8a-benzoylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] benzenecarbothioate (PubChem CID 139311668) has the molecular formula C32H27N3O6S2 and a molecular weight of 613.72 g/mol. Its IUPAC name is S-[(3S,7S,8aS)-6-(1,3-benzodioxol-5-yl)-8a-benzoylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] benzenecarbothioate.
| Compound Name | S-[(3S,7S,8aS)-6-(1,3-benzodioxol-5-yl)-8a-benzoylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 139311668 |
| Molecular Formula | C32H27N3O6S2 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.13 |
| IUPAC Name | S-[(3S,7S,8aS)-6-(1,3-benzodioxol-5-yl)-8a-benzoylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] benzenecarbothioate |
| SMILES | CN1C(=O)[C@@]2(SC(=O)c3ccccc3)C[C@](C)(C#N)C(c3ccc4c(c3)OCO4)N2C(=O)[C@]1(C)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H27N3O6S2/c1-30(18-33)17-32(43-27(37)21-12-8-5-9-13-21)29(39)34(3)31(2,42-26(36)20-10-6-4-7-11-20)28(38)35(32)25(30)22-14-15-23-24(16-22)41-19-40-23/h4-16,25H,17,19H2,1-3H3/t25?,30-,31+,32+/m1/s1 |
| InChIKey | MSCPESFCUGCETP-ADGAZUCJSA-N |
| XLogP | 5.25 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|