C19H21N5O4S2 — CID 139311221
S-[(3S,6S,7S,8aS)-8a-acetylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate (PubChem CID 139311221) has the molecular formula C19H21N5O4S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is S-[(3S,6S,7S,8aS)-8a-acetylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate.
| Compound Name | S-[(3S,6S,7S,8aS)-8a-acetylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 139311221 |
| Molecular Formula | C19H21N5O4S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | S-[(3S,6S,7S,8aS)-8a-acetylsulfanyl-7-cyano-2,3,7-trimethyl-1,4-dioxo-6-pyrimidin-5-yl-6,8-dihydropyrrolo[1,2-a]pyrazin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@]1(C)C(=O)N2[C@@H](c3cncnc3)[C@@](C)(C#N)C[C@]2(SC(C)=O)C(=O)N1C |
| InChI | InChI=1S/C19H21N5O4S2/c1-11(25)29-18(4)15(27)24-14(13-6-21-10-22-7-13)17(3,9-20)8-19(24,30-12(2)26)16(28)23(18)5/h6-7,10,14H,8H2,1-5H3/t14-,17+,18-,19-/m0/s1 |
| InChIKey | SRFUQVOCSPAOLR-VLQPXKRTSA-N |
| XLogP | 1.72 |
| TPSA | 124.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|