C20H19N3O4S2 — CID 155088251
(1S,3R,4R,7R)-4-(1,3-benzodioxol-5-yl)-3,11-dimethyl-6,10-dioxo-7-prop-1-en-2-yl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile (PubChem CID 155088251) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is (1S,3R,4R,7R)-4-(1,3-benzodioxol-5-yl)-3,11-dimethyl-6,10-dioxo-7-prop-1-en-2-yl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile.
| Compound Name | (1S,3R,4R,7R)-4-(1,3-benzodioxol-5-yl)-3,11-dimethyl-6,10-dioxo-7-prop-1-en-2-yl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 155088251 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (1S,3R,4R,7R)-4-(1,3-benzodioxol-5-yl)-3,11-dimethyl-6,10-dioxo-7-prop-1-en-2-yl-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
| SMILES | C=C(C)[C@@]12SS[C@@]3(C[C@@](C)(C#N)[C@@H](c4ccc5c(c4)OCO5)N3C1=O)C(=O)N2C |
| InChI | InChI=1S/C20H19N3O4S2/c1-11(2)20-17(25)23-15(12-5-6-13-14(7-12)27-10-26-13)18(3,9-21)8-19(23,28-29-20)16(24)22(20)4/h5-7,15H,1,8,10H2,2-4H3/t15-,18+,19+,20-/m1/s1 |
| InChIKey | FOOJJEUEKJOUGQ-XFWGSAIBSA-N |
| XLogP | 3.05 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|