C20H21N3O4S2 — CID 147789384
(3R,7S)-6-(1,3-benzodioxol-5-yl)-3,7-dimethyl-1,4-dioxo-2-prop-2-enyl-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 147789384) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3R,7S)-6-(1,3-benzodioxol-5-yl)-3,7-dimethyl-1,4-dioxo-2-prop-2-enyl-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3R,7S)-6-(1,3-benzodioxol-5-yl)-3,7-dimethyl-1,4-dioxo-2-prop-2-enyl-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 147789384 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | (3R,7S)-6-(1,3-benzodioxol-5-yl)-3,7-dimethyl-1,4-dioxo-2-prop-2-enyl-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | C=CCN1C(=O)C2(S)C[C@](C)(C#N)C(c3ccc4c(c3)OCO4)N2C(=O)[C@@]1(C)S |
| InChI | InChI=1S/C20H21N3O4S2/c1-4-7-22-17(25)20(29)9-18(2,10-21)15(23(20)16(24)19(22,3)28)12-5-6-13-14(8-12)27-11-26-13/h4-6,8,15,28-29H,1,7,9,11H2,2-3H3/t15?,18-,19-,20?/m1/s1 |
| InChIKey | HJICTYUUTFXZDV-QJTDPOQLSA-N |
| XLogP | 2.52 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|