C23H24N2O7S2 — CID 159650867
methyl [(3S,6S,7aR)-3-acetylsulfanyl-5-(1,3-benzodioxol-5-yl)-6-cyano-2,3,6-trimethyl-1,4-dioxo-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl]sulfanylformate (PubChem CID 159650867) has the molecular formula C23H24N2O7S2 and a molecular weight of 504.59 g/mol. Its IUPAC name is methyl [(3S,6S,7aR)-3-acetylsulfanyl-5-(1,3-benzodioxol-5-yl)-6-cyano-2,3,6-trimethyl-1,4-dioxo-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl]sulfanylformate.
| Compound Name | methyl [(3S,6S,7aR)-3-acetylsulfanyl-5-(1,3-benzodioxol-5-yl)-6-cyano-2,3,6-trimethyl-1,4-dioxo-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl]sulfanylformate |
|---|---|
| PubChem CID | 159650867 |
| Molecular Formula | C23H24N2O7S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | methyl [(3S,6S,7aR)-3-acetylsulfanyl-5-(1,3-benzodioxol-5-yl)-6-cyano-2,3,6-trimethyl-1,4-dioxo-5,7-dihydro-4aH-cyclopenta[c]pyridin-7a-yl]sulfanylformate |
| SMILES | COC(=O)S[C@]12C[C@](C)(C#N)C(c3ccc4c(c3)OCO4)C1C(=O)[C@](C)(SC(C)=O)N(C)C2=O |
| InChI | InChI=1S/C23H24N2O7S2/c1-12(26)33-22(3)18(27)17-16(13-6-7-14-15(8-13)32-11-31-14)21(2,10-24)9-23(17,19(28)25(22)4)34-20(29)30-5/h6-8,16-17H,9,11H2,1-5H3/t16?,17?,21-,22+,23-/m1/s1 |
| InChIKey | WYHXXBXVRCIFIM-FCGXABINSA-N |
| XLogP | 3.32 |
| TPSA | 123.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|