C18H28N2S4 — CID 102522084
tert-butyl-[[4-[[tert-butyl(dithiocarboxy)amino]methyl]phenyl]methyl]carbamodithioic acid (PubChem CID 102522084) has the molecular formula C18H28N2S4 and a molecular weight of 400.70 g/mol. Its IUPAC name is tert-butyl-[[4-[[tert-butyl(dithiocarboxy)amino]methyl]phenyl]methyl]carbamodithioic acid.
| Compound Name | tert-butyl-[[4-[[tert-butyl(dithiocarboxy)amino]methyl]phenyl]methyl]carbamodithioic acid |
|---|---|
| PubChem CID | 102522084 |
| Molecular Formula | C18H28N2S4 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | tert-butyl-[[4-[[tert-butyl(dithiocarboxy)amino]methyl]phenyl]methyl]carbamodithioic acid |
| SMILES | CC(C)(C)N(Cc1ccc(CN(C(=S)S)C(C)(C)C)cc1)C(=S)S |
| InChI | InChI=1S/C18H28N2S4/c1-17(2,3)19(15(21)22)11-13-7-9-14(10-8-13)12-20(16(23)24)18(4,5)6/h7-10H,11-12H2,1-6H3,(H,21,22)(H,23,24) |
| InChIKey | PGFMVJVTPUNGAI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|