C16H20NO3- — CID 6999226
4-[tert-butyl-[(4-methylphenyl)methyl]amino]-4-oxobut-2-enoate (PubChem CID 6999226) has the molecular formula C16H20NO3- and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-[tert-butyl-[(4-methylphenyl)methyl]amino]-4-oxobut-2-enoate.
| Compound Name | 4-[tert-butyl-[(4-methylphenyl)methyl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6999226 |
| Molecular Formula | C16H20NO3- |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-[tert-butyl-[(4-methylphenyl)methyl]amino]-4-oxobut-2-enoate |
| SMILES | Cc1ccc(CN(C(=O)C=CC(=O)[O-])C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H21NO3/c1-12-5-7-13(8-6-12)11-17(16(2,3)4)14(18)9-10-15(19)20/h5-10H,11H2,1-4H3,(H,19,20)/p-1 |
| InChIKey | RMMPSKPOPVXBHU-UHFFFAOYSA-M |
| XLogP | 1.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|