C22H34O4 — CID 102522532
[(2Z,5E,7R)-7-hydroxy-6,10-dimethyl-2-[(E)-4-methyl-6-oxohex-4-enylidene]undeca-5,9-dienyl] acetate (PubChem CID 102522532) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(2Z,5E,7R)-7-hydroxy-6,10-dimethyl-2-[(E)-4-methyl-6-oxohex-4-enylidene]undeca-5,9-dienyl] acetate.
| Compound Name | [(2Z,5E,7R)-7-hydroxy-6,10-dimethyl-2-[(E)-4-methyl-6-oxohex-4-enylidene]undeca-5,9-dienyl] acetate |
|---|---|
| PubChem CID | 102522532 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(2Z,5E,7R)-7-hydroxy-6,10-dimethyl-2-[(E)-4-methyl-6-oxohex-4-enylidene]undeca-5,9-dienyl] acetate |
| SMILES | CC(=O)OC/C(=C\CC/C(C)=C/C=O)CC/C=C(\C)[C@H](O)CC=C(C)C |
| InChI | InChI=1S/C22H34O4/c1-17(2)12-13-22(25)19(4)9-7-11-21(16-26-20(5)24)10-6-8-18(3)14-15-23/h9-10,12,14-15,22,25H,6-8,11,13,16H2,1-5H3/b18-14+,19-9+,21-10-/t22-/m1/s1 |
| InChIKey | ZOXDAANNUDSSLU-ORMYALOKSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|